C18H15N5O — CID 28871798
3-[3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazol-5-yl]benzonitrile (PubChem CID 28871798) has the molecular formula C18H15N5O and a molecular weight of 317.35 g/mol. Its IUPAC name is 3-[3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazol-5-yl]benzonitrile.
| Compound Name | 3-[3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 28871798 |
| Molecular Formula | C18H15N5O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 3-[3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazol-5-yl]benzonitrile |
| SMILES | Cc1ncc2c(c1-c1noc(-c3cccc(C#N)c3)n1)CCNC2 |
| InChI | InChI=1S/C18H15N5O/c1-11-16(15-5-6-20-9-14(15)10-21-11)17-22-18(24-23-17)13-4-2-3-12(7-13)8-19/h2-4,7,10,20H,5-6,9H2,1H3 |
| InChIKey | JADFSDMKFOEBMA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |