C19H17N7O — CID 28956775
3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-[3-(1,2,4-triazol-4-yl)phenyl]-1,2,4-oxadiazole (PubChem CID 28956775) has the molecular formula C19H17N7O and a molecular weight of 359.39 g/mol. Its IUPAC name is 3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-[3-(1,2,4-triazol-4-yl)phenyl]-1,2,4-oxadiazole.
| Compound Name | 3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-[3-(1,2,4-triazol-4-yl)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 28956775 |
| Molecular Formula | C19H17N7O |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-[3-(1,2,4-triazol-4-yl)phenyl]-1,2,4-oxadiazole |
| SMILES | Cc1ncc2c(c1-c1noc(-c3cccc(-n4cnnc4)c3)n1)CCNC2 |
| InChI | InChI=1S/C19H17N7O/c1-12-17(16-5-6-20-8-14(16)9-21-12)18-24-19(27-25-18)13-3-2-4-15(7-13)26-10-22-23-11-26/h2-4,7,9-11,20H,5-6,8H2,1H3 |
| InChIKey | BDIKPZHCQBTOGY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |