C16H12N4O — CID 104677257
3-[3-(3-ethyl-4-pyridinyl)-1,2,4-oxadiazol-5-yl]benzonitrile (PubChem CID 104677257) has the molecular formula C16H12N4O and a molecular weight of 276.30 g/mol. Its IUPAC name is 3-[3-(3-ethyl-4-pyridinyl)-1,2,4-oxadiazol-5-yl]benzonitrile.
| Compound Name | 3-[3-(3-ethyl-4-pyridinyl)-1,2,4-oxadiazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 104677257 |
| Molecular Formula | C16H12N4O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 3-[3-(3-ethyl-4-pyridinyl)-1,2,4-oxadiazol-5-yl]benzonitrile |
| SMILES | CCc1cnccc1-c1noc(-c2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C16H12N4O/c1-2-12-10-18-7-6-14(12)15-19-16(21-20-15)13-5-3-4-11(8-13)9-17/h3-8,10H,2H2,1H3 |
| InChIKey | PSDSLFWFNVCBDE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |