C14H20BrN3 — CID 113234614
5-bromo-2-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]pyridine (PubChem CID 113234614) has the molecular formula C14H20BrN3 and a molecular weight of 310.24 g/mol. Its IUPAC name is 5-bromo-2-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]pyridine.
| Compound Name | 5-bromo-2-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 113234614 |
| Molecular Formula | C14H20BrN3 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 5-bromo-2-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]pyridine |
| SMILES | Brc1ccc(CN2CCC(N3CCCC3)C2)nc1 |
| InChI | InChI=1S/C14H20BrN3/c15-12-3-4-13(16-9-12)10-17-8-5-14(11-17)18-6-1-2-7-18/h3-4,9,14H,1-2,5-8,10-11H2 |
| InChIKey | YAODCPZKGHMCHE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |