C11H14BrFN2 — CID 164659359
5-bromo-2-[(4-fluoropiperidin-1-yl)methyl]pyridine (PubChem CID 164659359) has the molecular formula C11H14BrFN2 and a molecular weight of 273.15 g/mol. Its IUPAC name is 5-bromo-2-[(4-fluoropiperidin-1-yl)methyl]pyridine.
| Compound Name | 5-bromo-2-[(4-fluoropiperidin-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 164659359 |
| Molecular Formula | C11H14BrFN2 |
| Molecular Weight | 273.15 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 5-bromo-2-[(4-fluoropiperidin-1-yl)methyl]pyridine |
| SMILES | FC1CCN(Cc2ccc(Br)cn2)CC1 |
| InChI | InChI=1S/C11H14BrFN2/c12-9-1-2-11(14-7-9)8-15-5-3-10(13)4-6-15/h1-2,7,10H,3-6,8H2 |
| InChIKey | MPZUPLKKPIQLMF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.15 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |