C9H16N4O2S2 — CID 113234769
N-(2-thiomorpholin-4-ylethyl)-1H-pyrazole-4-sulfonamide (PubChem CID 113234769) has the molecular formula C9H16N4O2S2 and a molecular weight of 276.39 g/mol. Its IUPAC name is N-(2-thiomorpholin-4-ylethyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(2-thiomorpholin-4-ylethyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 113234769 |
| Molecular Formula | C9H16N4O2S2 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | N-(2-thiomorpholin-4-ylethyl)-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(NCCN1CCSCC1)c1cn[nH]c1 |
| InChI | InChI=1S/C9H16N4O2S2/c14-17(15,9-7-10-11-8-9)12-1-2-13-3-5-16-6-4-13/h7-8,12H,1-6H2,(H,10,11) |
| InChIKey | PXWXYUDPGRQGBK-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |