C15H23NO3S — CID 113236594
3-methyl-N-[(E)-pent-3-enyl]-4-propan-2-yloxybenzenesulfonamide (PubChem CID 113236594) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 3-methyl-N-[(E)-pent-3-enyl]-4-propan-2-yloxybenzenesulfonamide.
| Compound Name | 3-methyl-N-[(E)-pent-3-enyl]-4-propan-2-yloxybenzenesulfonamide |
|---|---|
| PubChem CID | 113236594 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 3-methyl-N-[(E)-pent-3-enyl]-4-propan-2-yloxybenzenesulfonamide |
| SMILES | C/C=C/CCNS(=O)(=O)c1ccc(OC(C)C)c(C)c1 |
| InChI | InChI=1S/C15H23NO3S/c1-5-6-7-10-16-20(17,18)14-8-9-15(13(4)11-14)19-12(2)3/h5-6,8-9,11-12,16H,7,10H2,1-4H3/b6-5+ |
| InChIKey | GCIQFVZJFPNICA-AATRIKPKSA-N |
| XLogP | 3.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|