C12H14N4O2 — CID 113236894
4-acetyl-1-methyl-N-(4-methyl-1H-pyrazol-5-yl)pyrrole-2-carboxamide (PubChem CID 113236894) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 4-acetyl-1-methyl-N-(4-methyl-1H-pyrazol-5-yl)pyrrole-2-carboxamide.
| Compound Name | 4-acetyl-1-methyl-N-(4-methyl-1H-pyrazol-5-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 113236894 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 4-acetyl-1-methyl-N-(4-methyl-1H-pyrazol-5-yl)pyrrole-2-carboxamide |
| SMILES | CC(=O)c1cc(C(=O)Nc2[nH]ncc2C)n(C)c1 |
| InChI | InChI=1S/C12H14N4O2/c1-7-5-13-15-11(7)14-12(18)10-4-9(8(2)17)6-16(10)3/h4-6H,1-3H3,(H2,13,14,15,18) |
| InChIKey | IZTONUHYMXVXIK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |