About 4-acetyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-methylpyrrole-2-carboxamide
4-acetyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-methylpyrrole-2-carboxamide (PubChem CID 107845337) has the molecular formula C12H18N2O5
and a molecular weight of 270.28 g/mol. Its IUPAC name is 4-acetyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-methylpyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-acetyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-methylpyrrole-2-carboxamide |
| PubChem CID | 107845337 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 4-acetyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-methylpyrrole-2-carboxamide |
| SMILES | CC(=O)c1cc(C(=O)NC(CO)(CO)CO)n(C)c1 |
| InChI | InChI=1S/C12H18N2O5/c1-8(18)9-3-10(14(2)4-9)11(19)13-12(5-15,6-16)7-17/h3-4,15-17H,5-7H2,1-2H3,(H,13,19) |
| InChIKey | ATPRSDZTSMGTIH-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-acetyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-methylpyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-methylpyrrole-2-carboxamide?
The IUPAC name of 4-acetyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-methylpyrrole-2-carboxamide (CID 107845337) is 4-acetyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-methylpyrrole-2-carboxamide.
What is the SMILES notation for 4-acetyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-methylpyrrole-2-carboxamide?
The canonical SMILES for 4-acetyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-methylpyrrole-2-carboxamide is CC(=O)c1cc(C(=O)NC(CO)(CO)CO)n(C)c1.
What is the InChIKey of 4-acetyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-methylpyrrole-2-carboxamide?
The InChIKey is ATPRSDZTSMGTIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O5/c1-8(18)9-3-10(14(2)4-9)11(19)13-12(5-15,6-16)7-17/h3-4,15-17H,5-7H2,1-2H3,(H,13,19).
What are the key properties of 4-acetyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-methylpyrrole-2-carboxamide?
4-acetyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-methylpyrrole-2-carboxamide has a molecular weight of 270.28 g/mol, XLogP of -1.33, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-methylpyrrole-2-carboxamide is sourced from PubChem (CID 107845337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).