C11H16N2O3 — CID 83039564
4-acetyl-N-[(2R)-2-hydroxypropyl]-1-methylpyrrole-2-carboxamide (PubChem CID 83039564) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 4-acetyl-N-[(2R)-2-hydroxypropyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-acetyl-N-[(2R)-2-hydroxypropyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 83039564 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 4-acetyl-N-[(2R)-2-hydroxypropyl]-1-methylpyrrole-2-carboxamide |
| SMILES | CC(=O)c1cc(C(=O)NC[C@@H](C)O)n(C)c1 |
| InChI | InChI=1S/C11H16N2O3/c1-7(14)5-12-11(16)10-4-9(8(2)15)6-13(10)3/h4,6-7,14H,5H2,1-3H3,(H,12,16)/t7-/m1/s1 |
| InChIKey | MNLQEDHUJKZALL-SSDOTTSWSA-N |
| XLogP | 0.34 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |