C11H18N4O2 — CID 120828345
1-methyl-2-N-[2-(methylamino)propyl]pyrrole-2,4-dicarboxamide (PubChem CID 120828345) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-methyl-2-N-[2-(methylamino)propyl]pyrrole-2,4-dicarboxamide.
| Compound Name | 1-methyl-2-N-[2-(methylamino)propyl]pyrrole-2,4-dicarboxamide |
|---|---|
| PubChem CID | 120828345 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 1-methyl-2-N-[2-(methylamino)propyl]pyrrole-2,4-dicarboxamide |
| SMILES | CNC(C)CNC(=O)c1cc(C(N)=O)cn1C |
| InChI | InChI=1S/C11H18N4O2/c1-7(13-2)5-14-11(17)9-4-8(10(12)16)6-15(9)3/h4,6-7,13H,5H2,1-3H3,(H2,12,16)(H,14,17) |
| InChIKey | FSKAOIOBOGTMGY-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |