C12H20ClN3O2 — CID 120832160
4-acetyl-1-methyl-N-[2-(methylamino)propyl]pyrrole-2-carboxamide;hydrochloride (PubChem CID 120832160) has the molecular formula C12H20ClN3O2 and a molecular weight of 273.76 g/mol. Its IUPAC name is 4-acetyl-1-methyl-N-[2-(methylamino)propyl]pyrrole-2-carboxamide;hydrochloride.
| Compound Name | 4-acetyl-1-methyl-N-[2-(methylamino)propyl]pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120832160 |
| Molecular Formula | C12H20ClN3O2 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 4-acetyl-1-methyl-N-[2-(methylamino)propyl]pyrrole-2-carboxamide;hydrochloride |
| SMILES | CNC(C)CNC(=O)c1cc(C(C)=O)cn1C.Cl |
| InChI | InChI=1S/C12H19N3O2.ClH/c1-8(13-3)6-14-12(17)11-5-10(9(2)16)7-15(11)4;/h5,7-8,13H,6H2,1-4H3,(H,14,17);1H |
| InChIKey | UKZZPBXGXIHVEG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |