C15H16N4O3 — CID 136513814
1-methyl-2-N-[4-(methylcarbamoyl)phenyl]pyrrole-2,4-dicarboxamide (PubChem CID 136513814) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 1-methyl-2-N-[4-(methylcarbamoyl)phenyl]pyrrole-2,4-dicarboxamide.
| Compound Name | 1-methyl-2-N-[4-(methylcarbamoyl)phenyl]pyrrole-2,4-dicarboxamide |
|---|---|
| PubChem CID | 136513814 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-methyl-2-N-[4-(methylcarbamoyl)phenyl]pyrrole-2,4-dicarboxamide |
| SMILES | CNC(=O)c1ccc(NC(=O)c2cc(C(N)=O)cn2C)cc1 |
| InChI | InChI=1S/C15H16N4O3/c1-17-14(21)9-3-5-11(6-4-9)18-15(22)12-7-10(13(16)20)8-19(12)2/h3-8H,1-2H3,(H2,16,20)(H,17,21)(H,18,22) |
| InChIKey | HZCBFFJMMXYJMN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |