C14H16N4O4S — CID 29374337
N-(4-carbamoylphenyl)-1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxamide (PubChem CID 29374337) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxamide.
| Compound Name | N-(4-carbamoylphenyl)-1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 29374337 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-(4-carbamoylphenyl)-1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)Nc2ccc(C(N)=O)cc2)n(C)c1 |
| InChI | InChI=1S/C14H16N4O4S/c1-16-23(21,22)11-7-12(18(2)8-11)14(20)17-10-5-3-9(4-6-10)13(15)19/h3-8,16H,1-2H3,(H2,15,19)(H,17,20) |
| InChIKey | QIIJUVCWDHQKSP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |