C10H15N3O5S — CID 30063127
(2S)-2-[[1-methyl-4-(methylsulfamoyl)pyrrole-2-carbonyl]amino]propanoic acid (PubChem CID 30063127) has the molecular formula C10H15N3O5S and a molecular weight of 289.31 g/mol. Its IUPAC name is (2S)-2-[[1-methyl-4-(methylsulfamoyl)pyrrole-2-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[1-methyl-4-(methylsulfamoyl)pyrrole-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 30063127 |
| Molecular Formula | C10H15N3O5S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | (2S)-2-[[1-methyl-4-(methylsulfamoyl)pyrrole-2-carbonyl]amino]propanoic acid |
| SMILES | CNS(=O)(=O)c1cc(C(=O)N[C@@H](C)C(=O)O)n(C)c1 |
| InChI | InChI=1S/C10H15N3O5S/c1-6(10(15)16)12-9(14)8-4-7(5-13(8)3)19(17,18)11-2/h4-6,11H,1-3H3,(H,12,14)(H,15,16)/t6-/m0/s1 |
| InChIKey | GLCRFUMYHMDVAK-LURJTMIESA-N |
| XLogP | -0.86 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |