C12H21N3O4S — CID 43573443
N-(2-hydroxyethyl)-1-methyl-4-(methylsulfamoyl)-N-propan-2-ylpyrrole-2-carboxamide (PubChem CID 43573443) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-1-methyl-4-(methylsulfamoyl)-N-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-1-methyl-4-(methylsulfamoyl)-N-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43573443 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-(2-hydroxyethyl)-1-methyl-4-(methylsulfamoyl)-N-propan-2-ylpyrrole-2-carboxamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)N(CCO)C(C)C)n(C)c1 |
| InChI | InChI=1S/C12H21N3O4S/c1-9(2)15(5-6-16)12(17)11-7-10(8-14(11)4)20(18,19)13-3/h7-9,13,16H,5-6H2,1-4H3 |
| InChIKey | YVCKJCQARRASLL-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |