C12H20N4O4S — CID 32925642
N,1-dimethyl-5-[(3-methylbutanoylamino)carbamoyl]pyrrole-3-sulfonamide (PubChem CID 32925642) has the molecular formula C12H20N4O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is N,1-dimethyl-5-[(3-methylbutanoylamino)carbamoyl]pyrrole-3-sulfonamide.
| Compound Name | N,1-dimethyl-5-[(3-methylbutanoylamino)carbamoyl]pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 32925642 |
| Molecular Formula | C12H20N4O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N,1-dimethyl-5-[(3-methylbutanoylamino)carbamoyl]pyrrole-3-sulfonamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)NNC(=O)CC(C)C)n(C)c1 |
| InChI | InChI=1S/C12H20N4O4S/c1-8(2)5-11(17)14-15-12(18)10-6-9(7-16(10)4)21(19,20)13-3/h6-8,13H,5H2,1-4H3,(H,14,17)(H,15,18) |
| InChIKey | PUVNKSNDTDAQNM-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|