C13H17N3O3S2 — CID 94490887
1-methyl-4-(methylsulfamoyl)-N-[(1S)-1-thiophen-2-ylethyl]pyrrole-2-carboxamide (PubChem CID 94490887) has the molecular formula C13H17N3O3S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-methyl-4-(methylsulfamoyl)-N-[(1S)-1-thiophen-2-ylethyl]pyrrole-2-carboxamide.
| Compound Name | 1-methyl-4-(methylsulfamoyl)-N-[(1S)-1-thiophen-2-ylethyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 94490887 |
| Molecular Formula | C13H17N3O3S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 1-methyl-4-(methylsulfamoyl)-N-[(1S)-1-thiophen-2-ylethyl]pyrrole-2-carboxamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)N[C@@H](C)c2cccs2)n(C)c1 |
| InChI | InChI=1S/C13H17N3O3S2/c1-9(12-5-4-6-20-12)15-13(17)11-7-10(8-16(11)3)21(18,19)14-2/h4-9,14H,1-3H3,(H,15,17)/t9-/m0/s1 |
| InChIKey | UBKBGCIVIPVLKO-VIFPVBQESA-N |
| XLogP | 1.49 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |