C14H24N4O4S — CID 94025999
1-methyl-4-(methylsulfamoyl)-N-[(2R)-1-morpholin-4-ylpropan-2-yl]pyrrole-2-carboxamide (PubChem CID 94025999) has the molecular formula C14H24N4O4S and a molecular weight of 344.44 g/mol. Its IUPAC name is 1-methyl-4-(methylsulfamoyl)-N-[(2R)-1-morpholin-4-ylpropan-2-yl]pyrrole-2-carboxamide.
| Compound Name | 1-methyl-4-(methylsulfamoyl)-N-[(2R)-1-morpholin-4-ylpropan-2-yl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 94025999 |
| Molecular Formula | C14H24N4O4S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 1-methyl-4-(methylsulfamoyl)-N-[(2R)-1-morpholin-4-ylpropan-2-yl]pyrrole-2-carboxamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)N[C@H](C)CN2CCOCC2)n(C)c1 |
| InChI | InChI=1S/C14H24N4O4S/c1-11(9-18-4-6-22-7-5-18)16-14(19)13-8-12(10-17(13)3)23(20,21)15-2/h8,10-11,15H,4-7,9H2,1-3H3,(H,16,19)/t11-/m1/s1 |
| InChIKey | BLONQKZDQPLTHE-LLVKDONJSA-N |
| XLogP | -0.62 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |