C12H16N2O5 — CID 61243298
2-[(4-acetyl-1-methylpyrrole-2-carbonyl)amino]-4-hydroxybutanoic acid (PubChem CID 61243298) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-[(4-acetyl-1-methylpyrrole-2-carbonyl)amino]-4-hydroxybutanoic acid.
| Compound Name | 2-[(4-acetyl-1-methylpyrrole-2-carbonyl)amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 61243298 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-[(4-acetyl-1-methylpyrrole-2-carbonyl)amino]-4-hydroxybutanoic acid |
| SMILES | CC(=O)c1cc(C(=O)NC(CCO)C(=O)O)n(C)c1 |
| InChI | InChI=1S/C12H16N2O5/c1-7(16)8-5-10(14(2)6-8)11(17)13-9(3-4-15)12(18)19/h5-6,9,15H,3-4H2,1-2H3,(H,13,17)(H,18,19) |
| InChIKey | OTKVENYJQRHFCP-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |