C11H6F3N3O — CID 113238408
3,4,5-trifluoro-N-pyridazin-3-ylbenzamide (PubChem CID 113238408) has the molecular formula C11H6F3N3O and a molecular weight of 253.18 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-pyridazin-3-ylbenzamide.
| Compound Name | 3,4,5-trifluoro-N-pyridazin-3-ylbenzamide |
|---|---|
| PubChem CID | 113238408 |
| Molecular Formula | C11H6F3N3O |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 3,4,5-trifluoro-N-pyridazin-3-ylbenzamide |
| SMILES | O=C(Nc1cccnn1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H6F3N3O/c12-7-4-6(5-8(13)10(7)14)11(18)16-9-2-1-3-15-17-9/h1-5H,(H,16,17,18) |
| InChIKey | LMRDJWJLEQLXKW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|