C16H21N7O2 — CID 113242468
1-benzyl-5-[[4-(diethoxymethyl)triazol-1-yl]methyl]tetrazole (PubChem CID 113242468) has the molecular formula C16H21N7O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-benzyl-5-[[4-(diethoxymethyl)triazol-1-yl]methyl]tetrazole.
| Compound Name | 1-benzyl-5-[[4-(diethoxymethyl)triazol-1-yl]methyl]tetrazole |
|---|---|
| PubChem CID | 113242468 |
| Molecular Formula | C16H21N7O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 1-benzyl-5-[[4-(diethoxymethyl)triazol-1-yl]methyl]tetrazole |
| SMILES | CCOC(OCC)c1cn(Cc2nnnn2Cc2ccccc2)nn1 |
| InChI | InChI=1S/C16H21N7O2/c1-3-24-16(25-4-2)14-11-22(20-17-14)12-15-18-19-21-23(15)10-13-8-6-5-7-9-13/h5-9,11,16H,3-4,10,12H2,1-2H3 |
| InChIKey | ZOCIYNAOGVEJDO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 92.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|