C13H13BrClNO — CID 113242867
N-[(4-bromo-2-chlorophenyl)methyl]-1-(furan-2-yl)ethanamine (PubChem CID 113242867) has the molecular formula C13H13BrClNO and a molecular weight of 314.61 g/mol. Its IUPAC name is N-[(4-bromo-2-chlorophenyl)methyl]-1-(furan-2-yl)ethanamine.
| Compound Name | N-[(4-bromo-2-chlorophenyl)methyl]-1-(furan-2-yl)ethanamine |
|---|---|
| PubChem CID | 113242867 |
| Molecular Formula | C13H13BrClNO |
| Molecular Weight | 314.61 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | N-[(4-bromo-2-chlorophenyl)methyl]-1-(furan-2-yl)ethanamine |
| SMILES | CC(NCc1ccc(Br)cc1Cl)c1ccco1 |
| InChI | InChI=1S/C13H13BrClNO/c1-9(13-3-2-6-17-13)16-8-10-4-5-11(14)7-12(10)15/h2-7,9,16H,8H2,1H3 |
| InChIKey | VGKDOKITBVELEE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |