C13H12N4O — CID 113243841
N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]quinolin-2-amine (PubChem CID 113243841) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]quinolin-2-amine.
| Compound Name | N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]quinolin-2-amine |
|---|---|
| PubChem CID | 113243841 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]quinolin-2-amine |
| SMILES | Cc1nc(CNc2ccc3ccccc3n2)no1 |
| InChI | InChI=1S/C13H12N4O/c1-9-15-13(17-18-9)8-14-12-7-6-10-4-2-3-5-11(10)16-12/h2-7H,8H2,1H3,(H,14,16) |
| InChIKey | DQGRVAVOJBYSFZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |