C16H16N2S — CID 65244096
N-[(4,5-dimethylthiophen-2-yl)methyl]quinolin-2-amine (PubChem CID 65244096) has the molecular formula C16H16N2S and a molecular weight of 268.38 g/mol. Its IUPAC name is N-[(4,5-dimethylthiophen-2-yl)methyl]quinolin-2-amine.
| Compound Name | N-[(4,5-dimethylthiophen-2-yl)methyl]quinolin-2-amine |
|---|---|
| PubChem CID | 65244096 |
| Molecular Formula | C16H16N2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-[(4,5-dimethylthiophen-2-yl)methyl]quinolin-2-amine |
| SMILES | Cc1cc(CNc2ccc3ccccc3n2)sc1C |
| InChI | InChI=1S/C16H16N2S/c1-11-9-14(19-12(11)2)10-17-16-8-7-13-5-3-4-6-15(13)18-16/h3-9H,10H2,1-2H3,(H,17,18) |
| InChIKey | QFLKPGHMYZEOES-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |