C16H17N3S — CID 65246656
2-N-[(4,5-dimethylthiophen-2-yl)methyl]quinoline-2,6-diamine (PubChem CID 65246656) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-N-[(4,5-dimethylthiophen-2-yl)methyl]quinoline-2,6-diamine.
| Compound Name | 2-N-[(4,5-dimethylthiophen-2-yl)methyl]quinoline-2,6-diamine |
|---|---|
| PubChem CID | 65246656 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-N-[(4,5-dimethylthiophen-2-yl)methyl]quinoline-2,6-diamine |
| SMILES | Cc1cc(CNc2ccc3cc(N)ccc3n2)sc1C |
| InChI | InChI=1S/C16H17N3S/c1-10-7-14(20-11(10)2)9-18-16-6-3-12-8-13(17)4-5-15(12)19-16/h3-8H,9,17H2,1-2H3,(H,18,19) |
| InChIKey | CVBZPZTYCHHRBY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|