C11H15N3O4S — CID 113245393
1,3-dimethyl-2,4-dioxo-N-pent-4-yn-2-ylpyrimidine-5-sulfonamide (PubChem CID 113245393) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is 1,3-dimethyl-2,4-dioxo-N-pent-4-yn-2-ylpyrimidine-5-sulfonamide.
| Compound Name | 1,3-dimethyl-2,4-dioxo-N-pent-4-yn-2-ylpyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 113245393 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 1,3-dimethyl-2,4-dioxo-N-pent-4-yn-2-ylpyrimidine-5-sulfonamide |
| SMILES | C#CCC(C)NS(=O)(=O)c1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C11H15N3O4S/c1-5-6-8(2)12-19(17,18)9-7-13(3)11(16)14(4)10(9)15/h1,7-8,12H,6H2,2-4H3 |
| InChIKey | WDDYFGCOOVUHJJ-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|