C18H19F2N3O — CID 113248396
1-benzyl-5-[2-(difluoromethoxy)phenyl]-5-methyl-4H-imidazol-2-amine (PubChem CID 113248396) has the molecular formula C18H19F2N3O and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-benzyl-5-[2-(difluoromethoxy)phenyl]-5-methyl-4H-imidazol-2-amine.
| Compound Name | 1-benzyl-5-[2-(difluoromethoxy)phenyl]-5-methyl-4H-imidazol-2-amine |
|---|---|
| PubChem CID | 113248396 |
| Molecular Formula | C18H19F2N3O |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-benzyl-5-[2-(difluoromethoxy)phenyl]-5-methyl-4H-imidazol-2-amine |
| SMILES | CC1(c2ccccc2OC(F)F)CN=C(N)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H19F2N3O/c1-18(14-9-5-6-10-15(14)24-16(19)20)12-22-17(21)23(18)11-13-7-3-2-4-8-13/h2-10,16H,11-12H2,1H3,(H2,21,22) |
| InChIKey | GUKGHAAIWCEIQL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |