C19H36N2O3 — CID 113248612
tert-butyl 2-[2-[(1-hydroxycyclohexyl)methylamino]propyl]pyrrolidine-1-carboxylate (PubChem CID 113248612) has the molecular formula C19H36N2O3 and a molecular weight of 340.51 g/mol. Its IUPAC name is tert-butyl 2-[2-[(1-hydroxycyclohexyl)methylamino]propyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[(1-hydroxycyclohexyl)methylamino]propyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 113248612 |
| Molecular Formula | C19H36N2O3 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.27 |
| IUPAC Name | tert-butyl 2-[2-[(1-hydroxycyclohexyl)methylamino]propyl]pyrrolidine-1-carboxylate |
| SMILES | CC(CC1CCCN1C(=O)OC(C)(C)C)NCC1(O)CCCCC1 |
| InChI | InChI=1S/C19H36N2O3/c1-15(20-14-19(23)10-6-5-7-11-19)13-16-9-8-12-21(16)17(22)24-18(2,3)4/h15-16,20,23H,5-14H2,1-4H3 |
| InChIKey | TYUQBBHAIHHEEU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |