About 3-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide
3-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide (PubChem CID 113248627) has the molecular formula C10H16ClN3O3S2
and a molecular weight of 325.84 g/mol. Its IUPAC name is 3-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide |
| PubChem CID | 113248627 |
| Molecular Formula | C10H16ClN3O3S2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 3-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide |
| SMILES | CNC(=O)C(C)CN(C)S(=O)(=O)c1sc(Cl)nc1C |
| InChI | InChI=1S/C10H16ClN3O3S2/c1-6(8(15)12-3)5-14(4)19(16,17)9-7(2)13-10(11)18-9/h6H,5H2,1-4H3,(H,12,15) |
| InChIKey | WMUGBKRFDDMOGU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide?
The IUPAC name of 3-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide (CID 113248627) is 3-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide.
What is the SMILES notation for 3-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide?
The canonical SMILES for 3-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide is CNC(=O)C(C)CN(C)S(=O)(=O)c1sc(Cl)nc1C.
What is the InChIKey of 3-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide?
The InChIKey is WMUGBKRFDDMOGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClN3O3S2/c1-6(8(15)12-3)5-14(4)19(16,17)9-7(2)13-10(11)18-9/h6H,5H2,1-4H3,(H,12,15).
What are the key properties of 3-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide?
3-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide has a molecular weight of 325.84 g/mol, XLogP of 1.11, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl-methylamino]-N,2-dimethylpropanamide is sourced from PubChem (CID 113248627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).