C10H20N2O4S — CID 113249862
3-[2-(3-hydroxy-3-methylpyrrolidin-1-yl)ethylsulfonyl]propanamide (PubChem CID 113249862) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-[2-(3-hydroxy-3-methylpyrrolidin-1-yl)ethylsulfonyl]propanamide.
| Compound Name | 3-[2-(3-hydroxy-3-methylpyrrolidin-1-yl)ethylsulfonyl]propanamide |
|---|---|
| PubChem CID | 113249862 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 3-[2-(3-hydroxy-3-methylpyrrolidin-1-yl)ethylsulfonyl]propanamide |
| SMILES | CC1(O)CCN(CCS(=O)(=O)CCC(N)=O)C1 |
| InChI | InChI=1S/C10H20N2O4S/c1-10(14)3-4-12(8-10)5-7-17(15,16)6-2-9(11)13/h14H,2-8H2,1H3,(H2,11,13) |
| InChIKey | MLBRMCBAWMWQTP-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |