C11H25ClN2O2S — CID 120773462
[3-methyl-1-(2-propylsulfonylethyl)pyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120773462) has the molecular formula C11H25ClN2O2S and a molecular weight of 284.85 g/mol. Its IUPAC name is [3-methyl-1-(2-propylsulfonylethyl)pyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [3-methyl-1-(2-propylsulfonylethyl)pyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120773462 |
| Molecular Formula | C11H25ClN2O2S |
| Molecular Weight | 284.85 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | [3-methyl-1-(2-propylsulfonylethyl)pyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | CCCS(=O)(=O)CCN1CCC(C)(CN)C1.Cl |
| InChI | InChI=1S/C11H24N2O2S.ClH/c1-3-7-16(14,15)8-6-13-5-4-11(2,9-12)10-13;/h3-10,12H2,1-2H3;1H |
| InChIKey | HWGJSBRXUBJJNF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.85 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |