C13H27ClN2O3S — CID 120809078
1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-pentylsulfonylethanone;hydrochloride (PubChem CID 120809078) has the molecular formula C13H27ClN2O3S and a molecular weight of 326.89 g/mol. Its IUPAC name is 1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-pentylsulfonylethanone;hydrochloride.
| Compound Name | 1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-pentylsulfonylethanone;hydrochloride |
|---|---|
| PubChem CID | 120809078 |
| Molecular Formula | C13H27ClN2O3S |
| Molecular Weight | 326.89 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-pentylsulfonylethanone;hydrochloride |
| SMILES | CCCCCS(=O)(=O)CC(=O)N1CCC(C)(CN)C1.Cl |
| InChI | InChI=1S/C13H26N2O3S.ClH/c1-3-4-5-8-19(17,18)9-12(16)15-7-6-13(2,10-14)11-15;/h3-11,14H2,1-2H3;1H |
| InChIKey | WPGWKBDTMWGGIR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.89 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|