C12H24N2O3S — CID 120810105
1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-(2-methylpropylsulfonyl)ethanone (PubChem CID 120810105) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is 1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-(2-methylpropylsulfonyl)ethanone.
| Compound Name | 1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-(2-methylpropylsulfonyl)ethanone |
|---|---|
| PubChem CID | 120810105 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-(2-methylpropylsulfonyl)ethanone |
| SMILES | CC(C)CS(=O)(=O)CC(=O)N1CCC(C)(CN)C1 |
| InChI | InChI=1S/C12H24N2O3S/c1-10(2)6-18(16,17)7-11(15)14-5-4-12(3,8-13)9-14/h10H,4-9,13H2,1-3H3 |
| InChIKey | YZWFNXHZTVIUDY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |