C12H26ClN3O4S — CID 120805326
N-[2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-oxoethyl]-2-ethoxyethanesulfonamide;hydrochloride (PubChem CID 120805326) has the molecular formula C12H26ClN3O4S and a molecular weight of 343.88 g/mol. Its IUPAC name is N-[2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-oxoethyl]-2-ethoxyethanesulfonamide;hydrochloride.
| Compound Name | N-[2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-oxoethyl]-2-ethoxyethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120805326 |
| Molecular Formula | C12H26ClN3O4S |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-[2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-oxoethyl]-2-ethoxyethanesulfonamide;hydrochloride |
| SMILES | CCOCCS(=O)(=O)NCC(=O)N1CCC(C)(CN)C1.Cl |
| InChI | InChI=1S/C12H25N3O4S.ClH/c1-3-19-6-7-20(17,18)14-8-11(16)15-5-4-12(2,9-13)10-15;/h14H,3-10,13H2,1-2H3;1H |
| InChIKey | YRWORZRKSKWTSV-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|