C11H24ClN3O4S — CID 119634250
N-[2-[2-(aminomethyl)pyrrolidin-1-yl]-2-oxoethyl]-2-ethoxyethanesulfonamide;hydrochloride (PubChem CID 119634250) has the molecular formula C11H24ClN3O4S and a molecular weight of 329.85 g/mol. Its IUPAC name is N-[2-[2-(aminomethyl)pyrrolidin-1-yl]-2-oxoethyl]-2-ethoxyethanesulfonamide;hydrochloride.
| Compound Name | N-[2-[2-(aminomethyl)pyrrolidin-1-yl]-2-oxoethyl]-2-ethoxyethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119634250 |
| Molecular Formula | C11H24ClN3O4S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-[2-[2-(aminomethyl)pyrrolidin-1-yl]-2-oxoethyl]-2-ethoxyethanesulfonamide;hydrochloride |
| SMILES | CCOCCS(=O)(=O)NCC(=O)N1CCCC1CN.Cl |
| InChI | InChI=1S/C11H23N3O4S.ClH/c1-2-18-6-7-19(16,17)13-9-11(15)14-5-3-4-10(14)8-12;/h10,13H,2-9,12H2,1H3;1H |
| InChIKey | UINBVGYTZCBECB-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|