C14H29N3O4S — CID 119647948
2-ethoxy-N-[2-[4-(ethylaminomethyl)piperidin-1-yl]-2-oxoethyl]ethanesulfonamide (PubChem CID 119647948) has the molecular formula C14H29N3O4S and a molecular weight of 335.47 g/mol. Its IUPAC name is 2-ethoxy-N-[2-[4-(ethylaminomethyl)piperidin-1-yl]-2-oxoethyl]ethanesulfonamide.
| Compound Name | 2-ethoxy-N-[2-[4-(ethylaminomethyl)piperidin-1-yl]-2-oxoethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 119647948 |
| Molecular Formula | C14H29N3O4S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 2-ethoxy-N-[2-[4-(ethylaminomethyl)piperidin-1-yl]-2-oxoethyl]ethanesulfonamide |
| SMILES | CCNCC1CCN(C(=O)CNS(=O)(=O)CCOCC)CC1 |
| InChI | InChI=1S/C14H29N3O4S/c1-3-15-11-13-5-7-17(8-6-13)14(18)12-16-22(19,20)10-9-21-4-2/h13,15-16H,3-12H2,1-2H3 |
| InChIKey | JCRARGWZAOMWDB-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|