C16H25N3O4S — CID 71854144
2-ethoxy-N-[2-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-2-oxoethyl]ethanesulfonamide (PubChem CID 71854144) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-ethoxy-N-[2-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-2-oxoethyl]ethanesulfonamide.
| Compound Name | 2-ethoxy-N-[2-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-2-oxoethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 71854144 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 2-ethoxy-N-[2-(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-2-oxoethyl]ethanesulfonamide |
| SMILES | CCOCCS(=O)(=O)NCC(=O)N1CCN(C)c2ccccc2C1 |
| InChI | InChI=1S/C16H25N3O4S/c1-3-23-10-11-24(21,22)17-12-16(20)19-9-8-18(2)15-7-5-4-6-14(15)13-19/h4-7,17H,3,8-13H2,1-2H3 |
| InChIKey | SAJCUUCNNYNTJR-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|