C10H22N2O3S — CID 120777128
[1-(2-ethoxyethylsulfonyl)-3-methylpyrrolidin-3-yl]methanamine (PubChem CID 120777128) has the molecular formula C10H22N2O3S and a molecular weight of 250.36 g/mol. Its IUPAC name is [1-(2-ethoxyethylsulfonyl)-3-methylpyrrolidin-3-yl]methanamine.
| Compound Name | [1-(2-ethoxyethylsulfonyl)-3-methylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 120777128 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | [1-(2-ethoxyethylsulfonyl)-3-methylpyrrolidin-3-yl]methanamine |
| SMILES | CCOCCS(=O)(=O)N1CCC(C)(CN)C1 |
| InChI | InChI=1S/C10H22N2O3S/c1-3-15-6-7-16(13,14)12-5-4-10(2,8-11)9-12/h3-9,11H2,1-2H3 |
| InChIKey | VPTRDGKXOFJRBI-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|