C12H27ClN2O2S — CID 120777439
[3-methyl-1-(2-methylpentylsulfonyl)pyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120777439) has the molecular formula C12H27ClN2O2S and a molecular weight of 298.88 g/mol. Its IUPAC name is [3-methyl-1-(2-methylpentylsulfonyl)pyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [3-methyl-1-(2-methylpentylsulfonyl)pyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120777439 |
| Molecular Formula | C12H27ClN2O2S |
| Molecular Weight | 298.88 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | [3-methyl-1-(2-methylpentylsulfonyl)pyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | CCCC(C)CS(=O)(=O)N1CCC(C)(CN)C1.Cl |
| InChI | InChI=1S/C12H26N2O2S.ClH/c1-4-5-11(2)8-17(15,16)14-7-6-12(3,9-13)10-14;/h11H,4-10,13H2,1-3H3;1H |
| InChIKey | ZHEQVBZCTSUXNF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.88 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |