C14H31N3O2S — CID 106722636
4-[4-(2-propylsulfonylethyl)-1,4-diazepan-1-yl]butan-1-amine (PubChem CID 106722636) has the molecular formula C14H31N3O2S and a molecular weight of 305.49 g/mol. Its IUPAC name is 4-[4-(2-propylsulfonylethyl)-1,4-diazepan-1-yl]butan-1-amine.
| Compound Name | 4-[4-(2-propylsulfonylethyl)-1,4-diazepan-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 106722636 |
| Molecular Formula | C14H31N3O2S |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 4-[4-(2-propylsulfonylethyl)-1,4-diazepan-1-yl]butan-1-amine |
| SMILES | CCCS(=O)(=O)CCN1CCCN(CCCCN)CC1 |
| InChI | InChI=1S/C14H31N3O2S/c1-2-13-20(18,19)14-12-17-9-5-8-16(10-11-17)7-4-3-6-15/h2-15H2,1H3 |
| InChIKey | SOPWLDXAZKCVIN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|