C10H16N4O2S — CID 113251596
2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]-N-(2-methoxyethyl)acetamide (PubChem CID 113251596) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 113251596 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)amino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CNc1nc(C2CC2)ns1 |
| InChI | InChI=1S/C10H16N4O2S/c1-16-5-4-11-8(15)6-12-10-13-9(14-17-10)7-2-3-7/h7H,2-6H2,1H3,(H,11,15)(H,12,13,14) |
| InChIKey | ZFWZAHKEXUBKKY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|