C9H12F3N3OS — CID 65274036
3-cyclopropyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-thiadiazol-5-amine (PubChem CID 65274036) has the molecular formula C9H12F3N3OS and a molecular weight of 267.28 g/mol. Its IUPAC name is 3-cyclopropyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-cyclopropyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65274036 |
| Molecular Formula | C9H12F3N3OS |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 3-cyclopropyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-thiadiazol-5-amine |
| SMILES | FC(F)(F)COCCNc1nc(C2CC2)ns1 |
| InChI | InChI=1S/C9H12F3N3OS/c10-9(11,12)5-16-4-3-13-8-14-7(15-17-8)6-1-2-6/h6H,1-5H2,(H,13,14,15) |
| InChIKey | IJTPAHVNRQBACR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|