C12H20F3NO2 — CID 113252022
2-cycloheptyl-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide (PubChem CID 113252022) has the molecular formula C12H20F3NO2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-cycloheptyl-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide.
| Compound Name | 2-cycloheptyl-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 113252022 |
| Molecular Formula | C12H20F3NO2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-cycloheptyl-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide |
| SMILES | O=C(CC1CCCCCC1)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C12H20F3NO2/c13-12(14,15)10(17)8-16-11(18)7-9-5-3-1-2-4-6-9/h9-10,17H,1-8H2,(H,16,18) |
| InChIKey | VFKJQTNUGCEVBD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |