C14H21FN2S — CID 113254028
1-[2-(4-fluoro-2-methylphenyl)ethyl]-3-(2-methylpropyl)thiourea (PubChem CID 113254028) has the molecular formula C14H21FN2S and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-[2-(4-fluoro-2-methylphenyl)ethyl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[2-(4-fluoro-2-methylphenyl)ethyl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 113254028 |
| Molecular Formula | C14H21FN2S |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-[2-(4-fluoro-2-methylphenyl)ethyl]-3-(2-methylpropyl)thiourea |
| SMILES | Cc1cc(F)ccc1CCNC(=S)NCC(C)C |
| InChI | InChI=1S/C14H21FN2S/c1-10(2)9-17-14(18)16-7-6-12-4-5-13(15)8-11(12)3/h4-5,8,10H,6-7,9H2,1-3H3,(H2,16,17,18) |
| InChIKey | SDCXAKUKTVKYAC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|