C14H10ClFINO — CID 113255381
N-(2-chloro-5-iodophenyl)-2-(3-fluorophenyl)acetamide (PubChem CID 113255381) has the molecular formula C14H10ClFINO and a molecular weight of 389.60 g/mol. Its IUPAC name is N-(2-chloro-5-iodophenyl)-2-(3-fluorophenyl)acetamide.
| Compound Name | N-(2-chloro-5-iodophenyl)-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 113255381 |
| Molecular Formula | C14H10ClFINO |
| Molecular Weight | 389.60 g/mol |
| Exact Mass | 388.95 |
| IUPAC Name | N-(2-chloro-5-iodophenyl)-2-(3-fluorophenyl)acetamide |
| SMILES | O=C(Cc1cccc(F)c1)Nc1cc(I)ccc1Cl |
| InChI | InChI=1S/C14H10ClFINO/c15-12-5-4-11(17)8-13(12)18-14(19)7-9-2-1-3-10(16)6-9/h1-6,8H,7H2,(H,18,19) |
| InChIKey | DEAOYQKPAKEPKQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|