C13H13BrN2OS — CID 113255745
2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-4-carboxamide (PubChem CID 113255745) has the molecular formula C13H13BrN2OS and a molecular weight of 325.23 g/mol. Its IUPAC name is 2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-4-carboxamide.
| Compound Name | 2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 113255745 |
| Molecular Formula | C13H13BrN2OS |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 2-bromo-N-[(4,5-dimethylthiophen-2-yl)methyl]pyridine-4-carboxamide |
| SMILES | Cc1cc(CNC(=O)c2ccnc(Br)c2)sc1C |
| InChI | InChI=1S/C13H13BrN2OS/c1-8-5-11(18-9(8)2)7-16-13(17)10-3-4-15-12(14)6-10/h3-6H,7H2,1-2H3,(H,16,17) |
| InChIKey | FDKQQCFJPKORRA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|