C11H9BrN2OS — CID 103752408
2-bromo-N-(thiophen-3-ylmethyl)pyridine-4-carboxamide (PubChem CID 103752408) has the molecular formula C11H9BrN2OS and a molecular weight of 297.18 g/mol. Its IUPAC name is 2-bromo-N-(thiophen-3-ylmethyl)pyridine-4-carboxamide.
| Compound Name | 2-bromo-N-(thiophen-3-ylmethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103752408 |
| Molecular Formula | C11H9BrN2OS |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 295.96 |
| IUPAC Name | 2-bromo-N-(thiophen-3-ylmethyl)pyridine-4-carboxamide |
| SMILES | O=C(NCc1ccsc1)c1ccnc(Br)c1 |
| InChI | InChI=1S/C11H9BrN2OS/c12-10-5-9(1-3-13-10)11(15)14-6-8-2-4-16-7-8/h1-5,7H,6H2,(H,14,15) |
| InChIKey | FIEFASFETDIWJN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|