C17H28O6Si — CID 11325756
methyl (3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-oxo-7,7a-dihydro-3aH-1,3-benzodioxole-5-carboxylate (PubChem CID 11325756) has the molecular formula C17H28O6Si and a molecular weight of 356.49 g/mol. Its IUPAC name is methyl (3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-oxo-7,7a-dihydro-3aH-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl (3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-oxo-7,7a-dihydro-3aH-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 11325756 |
| Molecular Formula | C17H28O6Si |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | methyl (3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-oxo-7,7a-dihydro-3aH-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)C1=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]2C1=O |
| InChI | InChI=1S/C17H28O6Si/c1-16(2,3)24(7,8)23-11-9-10(15(19)20-6)12(18)14-13(11)21-17(4,5)22-14/h9,11,13-14H,1-8H3/t11-,13-,14+/m0/s1 |
| InChIKey | LGWNHXFXLJRDAB-FPMFFAJLSA-N |
| XLogP | 2.58 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|