C12H13ClINO3 — CID 113257827
ethyl 4-(4-chloro-2-iodoanilino)-4-oxobutanoate (PubChem CID 113257827) has the molecular formula C12H13ClINO3 and a molecular weight of 381.60 g/mol. Its IUPAC name is ethyl 4-(4-chloro-2-iodoanilino)-4-oxobutanoate.
| Compound Name | ethyl 4-(4-chloro-2-iodoanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 113257827 |
| Molecular Formula | C12H13ClINO3 |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 380.96 |
| IUPAC Name | ethyl 4-(4-chloro-2-iodoanilino)-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1ccc(Cl)cc1I |
| InChI | InChI=1S/C12H13ClINO3/c1-2-18-12(17)6-5-11(16)15-10-4-3-8(13)7-9(10)14/h3-4,7H,2,5-6H2,1H3,(H,15,16) |
| InChIKey | ZLIHPLDJBVOIAT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|